C22H22CuF3N7OS2 — CID 160848523
copper N'-[[2-(4-acetamidophenyl)-2-[[ethylamino(sulfido)methylidene]hydrazinylidene]-1-phenylethylidene]amino]-N-(2,2,2-trifluoroethyl)carbamimidothioate (PubChem CID 160848523) has the molecular formula C22H22CuF3N7OS2 and a molecular weight of 585.14 g/mol. Its IUPAC name is copper N'-[[2-(4-acetamidophenyl)-2-[[ethylamino(sulfido)methylidene]hydrazinylidene]-1-phenylethylidene]amino]-N-(2,2,2-trifluoroethyl)carbamimidothioate.
| Compound Name | copper N'-[[2-(4-acetamidophenyl)-2-[[ethylamino(sulfido)methylidene]hydrazinylidene]-1-phenylethylidene]amino]-N-(2,2,2-trifluoroethyl)carbamimidothioate |
|---|---|
| PubChem CID | 160848523 |
| Molecular Formula | C22H22CuF3N7OS2 |
| Molecular Weight | 585.14 g/mol |
| Exact Mass | 584.06 |
| IUPAC Name | copper N'-[[2-(4-acetamidophenyl)-2-[[ethylamino(sulfido)methylidene]hydrazinylidene]-1-phenylethylidene]amino]-N-(2,2,2-trifluoroethyl)carbamimidothioate |
| SMILES | CCNC([S-])=NN=C(C(=NN=C([S-])NCC(F)(F)F)c1ccccc1)c1ccc(NC(C)=O)cc1.[Cu+2] |
| InChI | InChI=1S/C22H24F3N7OS2.Cu/c1-3-26-20(34)31-30-19(16-9-11-17(12-10-16)28-14(2)33)18(15-7-5-4-6-8-15)29-32-21(35)27-13-22(23,24)25;/h4-12H,3,13H2,1-2H3,(H,28,33)(H2,26,31,34)(H2,27,32,35);/q;+2/p-2 |
| InChIKey | SIYMYVLXYYFCJM-UHFFFAOYSA-L |
| XLogP | 3.32 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.14 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|