C22H18CuF6N6OS2 — CID 142539101
copper N'-[(E)-[(2E)-1-(4-acetylphenyl)-2-phenyl-2-[(Z)-[sulfido-(2,2,2-trifluoroethylamino)methylidene]hydrazinylidene]ethylidene]amino]-N-(2,2,2-trifluoroethyl)carbamimidothioate (PubChem CID 142539101) has the molecular formula C22H18CuF6N6OS2 and a molecular weight of 624.10 g/mol. Its IUPAC name is copper N'-[(E)-[(2E)-1-(4-acetylphenyl)-2-phenyl-2-[(Z)-[sulfido-(2,2,2-trifluoroethylamino)methylidene]hydrazinylidene]ethylidene]amino]-N-(2,2,2-trifluoroethyl)carbamimidothioate.
| Compound Name | copper N'-[(E)-[(2E)-1-(4-acetylphenyl)-2-phenyl-2-[(Z)-[sulfido-(2,2,2-trifluoroethylamino)methylidene]hydrazinylidene]ethylidene]amino]-N-(2,2,2-trifluoroethyl)carbamimidothioate |
|---|---|
| PubChem CID | 142539101 |
| Molecular Formula | C22H18CuF6N6OS2 |
| Molecular Weight | 624.10 g/mol |
| Exact Mass | 623.02 |
| IUPAC Name | copper N'-[(E)-[(2E)-1-(4-acetylphenyl)-2-phenyl-2-[(Z)-[sulfido-(2,2,2-trifluoroethylamino)methylidene]hydrazinylidene]ethylidene]amino]-N-(2,2,2-trifluoroethyl)carbamimidothioate |
| SMILES | CC(=O)c1ccc(C(=N\N=C(/[S-])NCC(F)(F)F)/C(=N/N=C(\[S-])NCC(F)(F)F)c2ccccc2)cc1.[Cu+2] |
| InChI | InChI=1S/C22H20F6N6OS2.Cu/c1-13(35)14-7-9-16(10-8-14)18(32-34-20(37)30-12-22(26,27)28)17(15-5-3-2-4-6-15)31-33-19(36)29-11-21(23,24)25;/h2-10H,11-12H2,1H3,(H2,29,33,36)(H2,30,34,37);/q;+2/p-2/b31-17+,32-18+; |
| InChIKey | QFXZZBISOQMTTJ-UIEZAYFCSA-L |
| XLogP | 4.10 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.10 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|