C18H18CuN6OS2 — CID 162159955
copper N'-[[1-(4-hydroxyphenyl)-2-[[methylamino(sulfido)methylidene]hydrazinylidene]-2-phenylethylidene]amino]-N-methylcarbamimidothioate (PubChem CID 162159955) has the molecular formula C18H18CuN6OS2 and a molecular weight of 462.06 g/mol. Its IUPAC name is copper N'-[[1-(4-hydroxyphenyl)-2-[[methylamino(sulfido)methylidene]hydrazinylidene]-2-phenylethylidene]amino]-N-methylcarbamimidothioate.
| Compound Name | copper N'-[[1-(4-hydroxyphenyl)-2-[[methylamino(sulfido)methylidene]hydrazinylidene]-2-phenylethylidene]amino]-N-methylcarbamimidothioate |
|---|---|
| PubChem CID | 162159955 |
| Molecular Formula | C18H18CuN6OS2 |
| Molecular Weight | 462.06 g/mol |
| Exact Mass | 461.03 |
| IUPAC Name | copper N'-[[1-(4-hydroxyphenyl)-2-[[methylamino(sulfido)methylidene]hydrazinylidene]-2-phenylethylidene]amino]-N-methylcarbamimidothioate |
| SMILES | CNC([S-])=NN=C(C(=NN=C([S-])NC)c1ccc(O)cc1)c1ccccc1.[Cu+2] |
| InChI | InChI=1S/C18H20N6OS2.Cu/c1-19-17(26)23-21-15(12-6-4-3-5-7-12)16(22-24-18(27)20-2)13-8-10-14(25)11-9-13;/h3-11,25H,1-2H3,(H2,19,23,26)(H2,20,24,27);/q;+2/p-2 |
| InChIKey | ZMIMEYNRDWXEIY-UHFFFAOYSA-L |
| XLogP | 1.74 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.06 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|