C19H17CuF3N6S2 — CID 142539202
copper N'-[(E)-[(2E)-2-[(Z)-[amino(sulfido)methylidene]hydrazinylidene]-2-phenyl-1-[4-(2,2,2-trifluoroethyl)phenyl]ethylidene]amino]-N-methylcarbamimidothioate (PubChem CID 142539202) has the molecular formula C19H17CuF3N6S2 and a molecular weight of 514.06 g/mol. Its IUPAC name is copper N'-[(E)-[(2E)-2-[(Z)-[amino(sulfido)methylidene]hydrazinylidene]-2-phenyl-1-[4-(2,2,2-trifluoroethyl)phenyl]ethylidene]amino]-N-methylcarbamimidothioate.
| Compound Name | copper N'-[(E)-[(2E)-2-[(Z)-[amino(sulfido)methylidene]hydrazinylidene]-2-phenyl-1-[4-(2,2,2-trifluoroethyl)phenyl]ethylidene]amino]-N-methylcarbamimidothioate |
|---|---|
| PubChem CID | 142539202 |
| Molecular Formula | C19H17CuF3N6S2 |
| Molecular Weight | 514.06 g/mol |
| Exact Mass | 513.02 |
| IUPAC Name | copper N'-[(E)-[(2E)-2-[(Z)-[amino(sulfido)methylidene]hydrazinylidene]-2-phenyl-1-[4-(2,2,2-trifluoroethyl)phenyl]ethylidene]amino]-N-methylcarbamimidothioate |
| SMILES | CN/C([S-])=N/N=C(C(=N/N=C(/N)[S-])/c1ccccc1)\c1ccc(CC(F)(F)F)cc1.[Cu+2] |
| InChI | InChI=1S/C19H19F3N6S2.Cu/c1-24-18(30)28-26-16(14-9-7-12(8-10-14)11-19(20,21)22)15(25-27-17(23)29)13-5-3-2-4-6-13;/h2-10H,11H2,1H3,(H3,23,27,29)(H2,24,28,30);/q;+2/p-2/b25-15+,26-16+; |
| InChIKey | KIGKJDBGEMQKNJ-ZEXLHBTCSA-L |
| XLogP | 2.88 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.06 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|