C20H15BrCuF6N6S2 — CID 142539489
copper N'-[(E)-[(2E)-1-(4-bromophenyl)-2-phenyl-2-[(Z)-[sulfido-(2,2,2-trifluoroethylamino)methylidene]hydrazinylidene]ethylidene]amino]-N-(2,2,2-trifluoroethyl)carbamimidothioate (PubChem CID 142539489) has the molecular formula C20H15BrCuF6N6S2 and a molecular weight of 660.95 g/mol. Its IUPAC name is copper N'-[(E)-[(2E)-1-(4-bromophenyl)-2-phenyl-2-[(Z)-[sulfido-(2,2,2-trifluoroethylamino)methylidene]hydrazinylidene]ethylidene]amino]-N-(2,2,2-trifluoroethyl)carbamimidothioate.
| Compound Name | copper N'-[(E)-[(2E)-1-(4-bromophenyl)-2-phenyl-2-[(Z)-[sulfido-(2,2,2-trifluoroethylamino)methylidene]hydrazinylidene]ethylidene]amino]-N-(2,2,2-trifluoroethyl)carbamimidothioate |
|---|---|
| PubChem CID | 142539489 |
| Molecular Formula | C20H15BrCuF6N6S2 |
| Molecular Weight | 660.95 g/mol |
| Exact Mass | 658.92 |
| IUPAC Name | copper N'-[(E)-[(2E)-1-(4-bromophenyl)-2-phenyl-2-[(Z)-[sulfido-(2,2,2-trifluoroethylamino)methylidene]hydrazinylidene]ethylidene]amino]-N-(2,2,2-trifluoroethyl)carbamimidothioate |
| SMILES | FC(F)(F)CN/C([S-])=N/N=C(C(=N/N=C(\[S-])NCC(F)(F)F)/c1ccc(Br)cc1)\c1ccccc1.[Cu+2] |
| InChI | InChI=1S/C20H17BrF6N6S2.Cu/c21-14-8-6-13(7-9-14)16(31-33-18(35)29-11-20(25,26)27)15(12-4-2-1-3-5-12)30-32-17(34)28-10-19(22,23)24;/h1-9H,10-11H2,(H2,28,32,34)(H2,29,33,35);/q;+2/p-2/b30-15+,31-16+; |
| InChIKey | IMRIPHJTJXDCJU-UZEVXCOJSA-L |
| XLogP | 4.66 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.95 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|