C14H16CuF3N7S2 — CID 160771529
copper N-ethyl-N'-[[1-pyridin-2-yl-2-[[sulfido-(2,2,2-trifluoroethylamino)methylidene]hydrazinylidene]propylidene]amino]carbamimidothioate (PubChem CID 160771529) has the molecular formula C14H16CuF3N7S2 and a molecular weight of 467.01 g/mol. Its IUPAC name is copper N-ethyl-N'-[[1-pyridin-2-yl-2-[[sulfido-(2,2,2-trifluoroethylamino)methylidene]hydrazinylidene]propylidene]amino]carbamimidothioate.
| Compound Name | copper N-ethyl-N'-[[1-pyridin-2-yl-2-[[sulfido-(2,2,2-trifluoroethylamino)methylidene]hydrazinylidene]propylidene]amino]carbamimidothioate |
|---|---|
| PubChem CID | 160771529 |
| Molecular Formula | C14H16CuF3N7S2 |
| Molecular Weight | 467.01 g/mol |
| Exact Mass | 466.02 |
| IUPAC Name | copper N-ethyl-N'-[[1-pyridin-2-yl-2-[[sulfido-(2,2,2-trifluoroethylamino)methylidene]hydrazinylidene]propylidene]amino]carbamimidothioate |
| SMILES | CCNC([S-])=NN=C(C(C)=NN=C([S-])NCC(F)(F)F)c1ccccn1.[Cu+2] |
| InChI | InChI=1S/C14H18F3N7S2.Cu/c1-3-18-12(25)24-22-11(10-6-4-5-7-19-10)9(2)21-23-13(26)20-8-14(15,16)17;/h4-7H,3,8H2,1-2H3,(H2,18,24,25)(H2,20,23,26);/q;+2/p-2 |
| InChIKey | RZJOAFSJJJXPMH-UHFFFAOYSA-L |
| XLogP | 1.73 |
| TPSA | 86.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.01 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|