C19H23N7S2 — CID 161470445
1-ethyl-3-[[2-(ethylcarbamothioylhydrazinylidene)-1-phenyl-2-pyridin-2-ylethylidene]amino]thiourea (PubChem CID 161470445) has the molecular formula C19H23N7S2 and a molecular weight of 413.58 g/mol. Its IUPAC name is 1-ethyl-3-[[2-(ethylcarbamothioylhydrazinylidene)-1-phenyl-2-pyridin-2-ylethylidene]amino]thiourea.
| Compound Name | 1-ethyl-3-[[2-(ethylcarbamothioylhydrazinylidene)-1-phenyl-2-pyridin-2-ylethylidene]amino]thiourea |
|---|---|
| PubChem CID | 161470445 |
| Molecular Formula | C19H23N7S2 |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 1-ethyl-3-[[2-(ethylcarbamothioylhydrazinylidene)-1-phenyl-2-pyridin-2-ylethylidene]amino]thiourea |
| SMILES | CCNC(=S)NN=C(C(=NNC(=S)NCC)c1ccccn1)c1ccccc1 |
| InChI | InChI=1S/C19H23N7S2/c1-3-20-18(27)25-23-16(14-10-6-5-7-11-14)17(15-12-8-9-13-22-15)24-26-19(28)21-4-2/h5-13H,3-4H2,1-2H3,(H2,20,25,27)(H2,21,26,28) |
| InChIKey | FGLNKCTWPNZHGM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|