C15H15BrN4S — CID 54757237
1-[(E)-[(4-bromophenyl)-pyridin-2-ylmethylidene]amino]-3-ethylthiourea (PubChem CID 54757237) has the molecular formula C15H15BrN4S and a molecular weight of 363.28 g/mol. Its IUPAC name is 1-[(E)-[(4-bromophenyl)-pyridin-2-ylmethylidene]amino]-3-ethylthiourea.
| Compound Name | 1-[(E)-[(4-bromophenyl)-pyridin-2-ylmethylidene]amino]-3-ethylthiourea |
|---|---|
| PubChem CID | 54757237 |
| Molecular Formula | C15H15BrN4S |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 1-[(E)-[(4-bromophenyl)-pyridin-2-ylmethylidene]amino]-3-ethylthiourea |
| SMILES | CCNC(=S)N/N=C(\c1ccc(Br)cc1)c1ccccn1 |
| InChI | InChI=1S/C15H15BrN4S/c1-2-17-15(21)20-19-14(13-5-3-4-10-18-13)11-6-8-12(16)9-7-11/h3-10H,2H2,1H3,(H2,17,20,21)/b19-14+ |
| InChIKey | AKGAEWIIODEGJF-XMHGGMMESA-N |
| XLogP | 3.08 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|