C14H13BrN4S — CID 54757236
1-[(E)-[(4-bromophenyl)-pyridin-2-ylmethylidene]amino]-3-methylthiourea (PubChem CID 54757236) has the molecular formula C14H13BrN4S and a molecular weight of 349.26 g/mol. Its IUPAC name is 1-[(E)-[(4-bromophenyl)-pyridin-2-ylmethylidene]amino]-3-methylthiourea.
| Compound Name | 1-[(E)-[(4-bromophenyl)-pyridin-2-ylmethylidene]amino]-3-methylthiourea |
|---|---|
| PubChem CID | 54757236 |
| Molecular Formula | C14H13BrN4S |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | 1-[(E)-[(4-bromophenyl)-pyridin-2-ylmethylidene]amino]-3-methylthiourea |
| SMILES | CNC(=S)N/N=C(\c1ccc(Br)cc1)c1ccccn1 |
| InChI | InChI=1S/C14H13BrN4S/c1-16-14(20)19-18-13(12-4-2-3-9-17-12)10-5-7-11(15)8-6-10/h2-9H,1H3,(H2,16,19,20)/b18-13+ |
| InChIKey | LMPHCAITSQHHHG-QGOAFFKASA-N |
| XLogP | 2.69 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|