C14H25Br2N5S — CID 12799010
1-[2-(diethylamino)ethyl]-3-[(E)-1-pyridin-2-ylethylideneamino]thiourea;dihydrobromide (PubChem CID 12799010) has the molecular formula C14H25Br2N5S and a molecular weight of 455.26 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-3-[(E)-1-pyridin-2-ylethylideneamino]thiourea;dihydrobromide.
| Compound Name | 1-[2-(diethylamino)ethyl]-3-[(E)-1-pyridin-2-ylethylideneamino]thiourea;dihydrobromide |
|---|---|
| PubChem CID | 12799010 |
| Molecular Formula | C14H25Br2N5S |
| Molecular Weight | 455.26 g/mol |
| Exact Mass | 453.02 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-3-[(E)-1-pyridin-2-ylethylideneamino]thiourea;dihydrobromide |
| SMILES | Br.Br.CCN(CC)CCNC(=S)N/N=C(\C)c1ccccn1 |
| InChI | InChI=1S/C14H23N5S.2BrH/c1-4-19(5-2)11-10-16-14(20)18-17-12(3)13-8-6-7-9-15-13;;/h6-9H,4-5,10-11H2,1-3H3,(H2,16,18,20);2*1H/b17-12+;; |
| InChIKey | KMSABDDNXUJHEG-CWQUOYFRSA-N |
| XLogP | 2.77 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|