C11H14CuN8S2 — CID 161254972
copper N-methyl-N'-[[1-[[methylamino(sulfido)methylidene]hydrazinylidene]-1-pyrimidin-2-ylpropan-2-ylidene]amino]carbamimidothioate (PubChem CID 161254972) has the molecular formula C11H14CuN8S2 and a molecular weight of 385.97 g/mol. Its IUPAC name is copper N-methyl-N'-[[1-[[methylamino(sulfido)methylidene]hydrazinylidene]-1-pyrimidin-2-ylpropan-2-ylidene]amino]carbamimidothioate.
| Compound Name | copper N-methyl-N'-[[1-[[methylamino(sulfido)methylidene]hydrazinylidene]-1-pyrimidin-2-ylpropan-2-ylidene]amino]carbamimidothioate |
|---|---|
| PubChem CID | 161254972 |
| Molecular Formula | C11H14CuN8S2 |
| Molecular Weight | 385.97 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | copper N-methyl-N'-[[1-[[methylamino(sulfido)methylidene]hydrazinylidene]-1-pyrimidin-2-ylpropan-2-ylidene]amino]carbamimidothioate |
| SMILES | CNC([S-])=NN=C(C)C(=NN=C([S-])NC)c1ncccn1.[Cu+2] |
| InChI | InChI=1S/C11H16N8S2.Cu/c1-7(16-18-10(20)12-2)8(17-19-11(21)13-3)9-14-5-4-6-15-9;/h4-6H,1-3H3,(H2,12,18,20)(H2,13,19,21);/q;+2/p-2 |
| InChIKey | VBUBWMYMEFKLDN-UHFFFAOYSA-L |
| XLogP | -0.20 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.97 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|