C13H15CuN5OS2 — CID 153455625
copper (Z)-ethoxy-[(E)-[(2E)-2-[(Z)-[methylamino(sulfido)methylidene]hydrazinylidene]-1-phenylethylidene]hydrazinylidene]-sulfidomethane (PubChem CID 153455625) has the molecular formula C13H15CuN5OS2 and a molecular weight of 384.98 g/mol. Its IUPAC name is copper (Z)-ethoxy-[(E)-[(2E)-2-[(Z)-[methylamino(sulfido)methylidene]hydrazinylidene]-1-phenylethylidene]hydrazinylidene]-sulfidomethane.
| Compound Name | copper (Z)-ethoxy-[(E)-[(2E)-2-[(Z)-[methylamino(sulfido)methylidene]hydrazinylidene]-1-phenylethylidene]hydrazinylidene]-sulfidomethane |
|---|---|
| PubChem CID | 153455625 |
| Molecular Formula | C13H15CuN5OS2 |
| Molecular Weight | 384.98 g/mol |
| Exact Mass | 384.00 |
| IUPAC Name | copper (Z)-ethoxy-[(E)-[(2E)-2-[(Z)-[methylamino(sulfido)methylidene]hydrazinylidene]-1-phenylethylidene]hydrazinylidene]-sulfidomethane |
| SMILES | CCO/C([S-])=N/N=C(/C=N/N=C(\[S-])NC)c1ccccc1.[Cu+2] |
| InChI | InChI=1S/C13H17N5OS2.Cu/c1-3-19-13(21)18-16-11(9-15-17-12(20)14-2)10-7-5-4-6-8-10;/h4-9H,3H2,1-2H3,(H,18,21)(H2,14,17,20);/q;+2/p-2/b15-9+,16-11-; |
| InChIKey | AONYRWHJEBABHE-RESUSKOASA-L |
| XLogP | 1.44 |
| TPSA | 70.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.98 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|