C14H17CuN5OS2 — CID 153455621
copper (Z)-[(E)-[(2E)-2-[(Z)-[dimethylamino(sulfido)methylidene]hydrazinylidene]-1-phenylethylidene]hydrazinylidene]-ethoxy-sulfidomethane (PubChem CID 153455621) has the molecular formula C14H17CuN5OS2 and a molecular weight of 399.00 g/mol. Its IUPAC name is copper (Z)-[(E)-[(2E)-2-[(Z)-[dimethylamino(sulfido)methylidene]hydrazinylidene]-1-phenylethylidene]hydrazinylidene]-ethoxy-sulfidomethane.
| Compound Name | copper (Z)-[(E)-[(2E)-2-[(Z)-[dimethylamino(sulfido)methylidene]hydrazinylidene]-1-phenylethylidene]hydrazinylidene]-ethoxy-sulfidomethane |
|---|---|
| PubChem CID | 153455621 |
| Molecular Formula | C14H17CuN5OS2 |
| Molecular Weight | 399.00 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | copper (Z)-[(E)-[(2E)-2-[(Z)-[dimethylamino(sulfido)methylidene]hydrazinylidene]-1-phenylethylidene]hydrazinylidene]-ethoxy-sulfidomethane |
| SMILES | CCO/C([S-])=N/N=C(/C=N/N=C(\[S-])N(C)C)c1ccccc1.[Cu+2] |
| InChI | InChI=1S/C14H19N5OS2.Cu/c1-4-20-14(22)18-16-12(11-8-6-5-7-9-11)10-15-17-13(21)19(2)3;/h5-10H,4H2,1-3H3,(H,17,21)(H,18,22);/q;+2/p-2/b15-10+,16-12-; |
| InChIKey | WJGVMYKBALGERU-CABKONKMSA-L |
| XLogP | 1.78 |
| TPSA | 61.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.00 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|