C9H15N5NiOS2 — CID 153455618
(Z)-ethoxy-[(E)-[(3E)-3-[(Z)-[methylamino(sulfido)methylidene]hydrazinylidene]butan-2-ylidene]hydrazinylidene]-sulfidomethane;nickel(2+) (PubChem CID 153455618) has the molecular formula C9H15N5NiOS2 and a molecular weight of 332.08 g/mol. Its IUPAC name is (Z)-ethoxy-[(E)-[(3E)-3-[(Z)-[methylamino(sulfido)methylidene]hydrazinylidene]butan-2-ylidene]hydrazinylidene]-sulfidomethane;nickel(2+).
| Compound Name | (Z)-ethoxy-[(E)-[(3E)-3-[(Z)-[methylamino(sulfido)methylidene]hydrazinylidene]butan-2-ylidene]hydrazinylidene]-sulfidomethane;nickel(2+) |
|---|---|
| PubChem CID | 153455618 |
| Molecular Formula | C9H15N5NiOS2 |
| Molecular Weight | 332.08 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | (Z)-ethoxy-[(E)-[(3E)-3-[(Z)-[methylamino(sulfido)methylidene]hydrazinylidene]butan-2-ylidene]hydrazinylidene]-sulfidomethane;nickel(2+) |
| SMILES | CCO/C([S-])=N/N=C(C)/C(C)=N/N=C(\[S-])NC.[Ni+2] |
| InChI | InChI=1S/C9H17N5OS2.Ni/c1-5-15-9(17)14-12-7(3)6(2)11-13-8(16)10-4;/h5H2,1-4H3,(H,14,17)(H2,10,13,16);/q;+2/p-2/b11-6+,12-7+; |
| InChIKey | MNQVBSBACMYPAO-BBLKRJOSSA-L |
| XLogP | 0.80 |
| TPSA | 70.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.08 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|