About bis(ethoxymethanedithioate);platinum-191(2+)
bis(ethoxymethanedithioate);platinum-191(2+) (PubChem CID 10048477) has the molecular formula C6H10O2PtS4
and a molecular weight of 433.37 g/mol. Its IUPAC name is bis(ethoxymethanedithioate);platinum-191(2+).
Molecular Properties
| Compound Name | bis(ethoxymethanedithioate);platinum-191(2+) |
| PubChem CID | 10048477 |
| Molecular Formula | C6H10O2PtS4 |
| Molecular Weight | 433.37 g/mol |
| Exact Mass | 432.92 |
| IUPAC Name | bis(ethoxymethanedithioate);platinum-191(2+) |
| SMILES | CCOC(=S)[S-].CCOC(=S)[S-].[191Pt+2] |
| InChI | InChI=1S/2C3H6OS2.Pt/c2*1-2-4-3(5)6;/h2*2H2,1H3,(H,5,6);/q;;+2/p-2/i;;1-4 |
| InChIKey | QKPUQQPOYHTDSR-WUYZZQIKSA-L |
| XLogP | 1.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze bis(ethoxymethanedithioate);platinum-191(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(ethoxymethanedithioate);platinum-191(2+)?
The IUPAC name of bis(ethoxymethanedithioate);platinum-191(2+) (CID 10048477) is bis(ethoxymethanedithioate);platinum-191(2+).
What is the SMILES notation for bis(ethoxymethanedithioate);platinum-191(2+)?
The canonical SMILES for bis(ethoxymethanedithioate);platinum-191(2+) is CCOC(=S)[S-].CCOC(=S)[S-].[191Pt+2].
What is the InChIKey of bis(ethoxymethanedithioate);platinum-191(2+)?
The InChIKey is QKPUQQPOYHTDSR-WUYZZQIKSA-L. The full InChI is InChI=1S/2C3H6OS2.Pt/c2*1-2-4-3(5)6;/h2*2H2,1H3,(H,5,6);/q;;+2/p-2/i;;1-4.
What are the key properties of bis(ethoxymethanedithioate);platinum-191(2+)?
bis(ethoxymethanedithioate);platinum-191(2+) has a molecular weight of 433.37 g/mol, XLogP of 1.71, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(ethoxymethanedithioate);platinum-191(2+) is sourced from PubChem (CID 10048477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).