About sodium;ethoxymethanedithioate;sulfuric acid
sodium;ethoxymethanedithioate;sulfuric acid (PubChem CID 174872749) has the molecular formula C3H7NaO5S3
and a molecular weight of 242.27 g/mol. Its IUPAC name is sodium;ethoxymethanedithioate;sulfuric acid.
Molecular Properties
| Compound Name | sodium;ethoxymethanedithioate;sulfuric acid |
| PubChem CID | 174872749 |
| Molecular Formula | C3H7NaO5S3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 241.94 |
| IUPAC Name | sodium;ethoxymethanedithioate;sulfuric acid |
| SMILES | CCOC(=S)[S-].O=S(=O)(O)O.[Na+] |
| InChI | InChI=1S/C3H6OS2.Na.H2O4S/c1-2-4-3(5)6;;1-5(2,3)4/h2H2,1H3,(H,5,6);;(H2,1,2,3,4)/q;+1;/p-1 |
| InChIKey | NUIIZBHLWXFRBC-UHFFFAOYSA-M |
| XLogP | -2.79 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;ethoxymethanedithioate;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;ethoxymethanedithioate;sulfuric acid?
The IUPAC name of sodium;ethoxymethanedithioate;sulfuric acid (CID 174872749) is sodium;ethoxymethanedithioate;sulfuric acid.
What is the SMILES notation for sodium;ethoxymethanedithioate;sulfuric acid?
The canonical SMILES for sodium;ethoxymethanedithioate;sulfuric acid is CCOC(=S)[S-].O=S(=O)(O)O.[Na+].
What is the InChIKey of sodium;ethoxymethanedithioate;sulfuric acid?
The InChIKey is NUIIZBHLWXFRBC-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6OS2.Na.H2O4S/c1-2-4-3(5)6;;1-5(2,3)4/h2H2,1H3,(H,5,6);;(H2,1,2,3,4)/q;+1;/p-1.
What are the key properties of sodium;ethoxymethanedithioate;sulfuric acid?
sodium;ethoxymethanedithioate;sulfuric acid has a molecular weight of 242.27 g/mol, XLogP of -2.79, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;ethoxymethanedithioate;sulfuric acid is sourced from PubChem (CID 174872749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).