About lithium ethoxymethanedithioate
lithium ethoxymethanedithioate (PubChem CID 23681493) has the molecular formula C3H5LiOS2
and a molecular weight of 128.15 g/mol. Its IUPAC name is lithium ethoxymethanedithioate.
Molecular Properties
| Compound Name | lithium ethoxymethanedithioate |
| PubChem CID | 23681493 |
| Molecular Formula | C3H5LiOS2 |
| Molecular Weight | 128.15 g/mol |
| Exact Mass | 127.99 |
| IUPAC Name | lithium ethoxymethanedithioate |
| SMILES | CCOC(=S)[S-].[Li+] |
| InChI | InChI=1S/C3H6OS2.Li/c1-2-4-3(5)6;/h2H2,1H3,(H,5,6);/q;+1/p-1 |
| InChIKey | SKMLRDJQWWVKDZ-UHFFFAOYSA-M |
| XLogP | -2.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.15 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze lithium ethoxymethanedithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium ethoxymethanedithioate?
The IUPAC name of lithium ethoxymethanedithioate (CID 23681493) is lithium ethoxymethanedithioate.
What is the SMILES notation for lithium ethoxymethanedithioate?
The canonical SMILES for lithium ethoxymethanedithioate is CCOC(=S)[S-].[Li+].
What is the InChIKey of lithium ethoxymethanedithioate?
The InChIKey is SKMLRDJQWWVKDZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6OS2.Li/c1-2-4-3(5)6;/h2H2,1H3,(H,5,6);/q;+1/p-1.
What are the key properties of lithium ethoxymethanedithioate?
lithium ethoxymethanedithioate has a molecular weight of 128.15 g/mol, XLogP of -2.14, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium ethoxymethanedithioate is sourced from PubChem (CID 23681493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).