About nickel(2+);bis(pentoxymethanedithioate)
nickel(2+);bis(pentoxymethanedithioate) (PubChem CID 14619578) has the molecular formula C12H22NiO2S4
and a molecular weight of 385.27 g/mol. Its IUPAC name is nickel(2+);bis(pentoxymethanedithioate).
Molecular Properties
| Compound Name | nickel(2+);bis(pentoxymethanedithioate) |
| PubChem CID | 14619578 |
| Molecular Formula | C12H22NiO2S4 |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 383.99 |
| IUPAC Name | nickel(2+);bis(pentoxymethanedithioate) |
| SMILES | CCCCCOC(=S)[S-].CCCCCOC(=S)[S-].[Ni+2] |
| InChI | InChI=1S/2C6H12OS2.Ni/c2*1-2-3-4-5-7-6(8)9;/h2*2-5H2,1H3,(H,8,9);/q;;+2/p-2 |
| InChIKey | SEBFZASNRWBOAW-UHFFFAOYSA-L |
| XLogP | 4.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze nickel(2+);bis(pentoxymethanedithioate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel(2+);bis(pentoxymethanedithioate)?
The IUPAC name of nickel(2+);bis(pentoxymethanedithioate) (CID 14619578) is nickel(2+);bis(pentoxymethanedithioate).
What is the SMILES notation for nickel(2+);bis(pentoxymethanedithioate)?
The canonical SMILES for nickel(2+);bis(pentoxymethanedithioate) is CCCCCOC(=S)[S-].CCCCCOC(=S)[S-].[Ni+2].
What is the InChIKey of nickel(2+);bis(pentoxymethanedithioate)?
The InChIKey is SEBFZASNRWBOAW-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H12OS2.Ni/c2*1-2-3-4-5-7-6(8)9;/h2*2-5H2,1H3,(H,8,9);/q;;+2/p-2.
What are the key properties of nickel(2+);bis(pentoxymethanedithioate)?
nickel(2+);bis(pentoxymethanedithioate) has a molecular weight of 385.27 g/mol, XLogP of 4.05, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for nickel(2+);bis(pentoxymethanedithioate) is sourced from PubChem (CID 14619578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).