About O-dodecyl 2-hydroxypropanethioate
O-dodecyl 2-hydroxypropanethioate (PubChem CID 88776030) has the molecular formula C15H30O2S
and a molecular weight of 274.47 g/mol. Its IUPAC name is O-dodecyl 2-hydroxypropanethioate.
Molecular Properties
| Compound Name | O-dodecyl 2-hydroxypropanethioate |
| PubChem CID | 88776030 |
| Molecular Formula | C15H30O2S |
| Molecular Weight | 274.47 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | O-dodecyl 2-hydroxypropanethioate |
| SMILES | CCCCCCCCCCCCOC(=S)C(C)O |
| InChI | InChI=1S/C15H30O2S/c1-3-4-5-6-7-8-9-10-11-12-13-17-15(18)14(2)16/h14,16H,3-13H2,1-2H3 |
| InChIKey | FKTOAMZRGXURBN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-dodecyl 2-hydroxypropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-dodecyl 2-hydroxypropanethioate?
The IUPAC name of O-dodecyl 2-hydroxypropanethioate (CID 88776030) is O-dodecyl 2-hydroxypropanethioate.
What is the SMILES notation for O-dodecyl 2-hydroxypropanethioate?
The canonical SMILES for O-dodecyl 2-hydroxypropanethioate is CCCCCCCCCCCCOC(=S)C(C)O.
What is the InChIKey of O-dodecyl 2-hydroxypropanethioate?
The InChIKey is FKTOAMZRGXURBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O2S/c1-3-4-5-6-7-8-9-10-11-12-13-17-15(18)14(2)16/h14,16H,3-13H2,1-2H3.
What are the key properties of O-dodecyl 2-hydroxypropanethioate?
O-dodecyl 2-hydroxypropanethioate has a molecular weight of 274.47 g/mol, XLogP of 4.63, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-dodecyl 2-hydroxypropanethioate is sourced from PubChem (CID 88776030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).