About CID 157091532
CID 157091532 (PubChem CID 157091532) has the molecular formula C15H15AsOS2
and a molecular weight of 350.34 g/mol.
Molecular Properties
| Compound Name | CID 157091532 |
| PubChem CID | 157091532 |
| Molecular Formula | C15H15AsOS2 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | — |
| SMILES | CCOC(=S)[S-].c1ccc([As+]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10As.C3H6OS2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-4-3(5)6/h1-10H;2H2,1H3,(H,5,6)/q+1;/p-1 |
| InChIKey | AESKOVIMUVHXTQ-UHFFFAOYSA-M |
| XLogP | 2.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 157091532 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157091532?
The IUPAC name of CID 157091532 (CID 157091532) is not available.
What is the SMILES notation for CID 157091532?
The canonical SMILES for CID 157091532 is CCOC(=S)[S-].c1ccc([As+]c2ccccc2)cc1.
What is the InChIKey of CID 157091532?
The InChIKey is AESKOVIMUVHXTQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H10As.C3H6OS2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-4-3(5)6/h1-10H;2H2,1H3,(H,5,6)/q+1;/p-1.
What are the key properties of CID 157091532?
CID 157091532 has a molecular weight of 350.34 g/mol, XLogP of 2.20, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157091532 is sourced from PubChem (CID 157091532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).