C23H19AuOPS3+ — CID 163254540
ethoxymethanedithioate;gold(1+);15-phenyl-12-thia-15-phosphoniatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5(16),6,8,10,13-heptaene (PubChem CID 163254540) has the molecular formula C23H19AuOPS3+ and a molecular weight of 635.55 g/mol. Its IUPAC name is ethoxymethanedithioate;gold(1+);15-phenyl-12-thia-15-phosphoniatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5(16),6,8,10,13-heptaene.
| Compound Name | ethoxymethanedithioate;gold(1+);15-phenyl-12-thia-15-phosphoniatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5(16),6,8,10,13-heptaene |
|---|---|
| PubChem CID | 163254540 |
| Molecular Formula | C23H19AuOPS3+ |
| Molecular Weight | 635.55 g/mol |
| Exact Mass | 635.00 |
| IUPAC Name | ethoxymethanedithioate;gold(1+);15-phenyl-12-thia-15-phosphoniatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5(16),6,8,10,13-heptaene |
| SMILES | CCOC(=S)[S-].[Au+].c1ccc([PH+]2c3cscc3-c3cccc4cccc2c34)cc1 |
| InChI | InChI=1S/C20H13PS.C3H6OS2.Au/c1-2-8-15(9-3-1)21-18-11-5-7-14-6-4-10-16(20(14)18)17-12-22-13-19(17)21;1-2-4-3(5)6;/h1-13H;2H2,1H3,(H,5,6);/q;;+1 |
| InChIKey | UHNYWEMSYZHXAZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|