C6H14N2O — CID 167034906
(E)-1-ethoxy-N,N'-dimethylethene-1,2-diamine (PubChem CID 167034906) has the molecular formula C6H14N2O and a molecular weight of 130.19 g/mol. Its IUPAC name is (E)-1-ethoxy-N,N'-dimethylethene-1,2-diamine.
| Compound Name | (E)-1-ethoxy-N,N'-dimethylethene-1,2-diamine |
|---|---|
| PubChem CID | 167034906 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | (E)-1-ethoxy-N,N'-dimethylethene-1,2-diamine |
| SMILES | CCO/C(=C/NC)NC |
| InChI | InChI=1S/C6H14N2O/c1-4-9-6(8-3)5-7-2/h5,7-8H,4H2,1-3H3/b6-5+ |
| InChIKey | HIQFDFAZNVGMMF-AATRIKPKSA-N |
| XLogP | 0.26 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|