C12H14CuN6S2 — CID 142539464
copper N-methyl-N'-[(E)-[(2E)-2-[(Z)-[methylamino(sulfido)methylidene]hydrazinylidene]-1-phenylethylidene]amino]carbamimidothioate (PubChem CID 142539464) has the molecular formula C12H14CuN6S2 and a molecular weight of 369.97 g/mol. Its IUPAC name is copper N-methyl-N'-[(E)-[(2E)-2-[(Z)-[methylamino(sulfido)methylidene]hydrazinylidene]-1-phenylethylidene]amino]carbamimidothioate.
| Compound Name | copper N-methyl-N'-[(E)-[(2E)-2-[(Z)-[methylamino(sulfido)methylidene]hydrazinylidene]-1-phenylethylidene]amino]carbamimidothioate |
|---|---|
| PubChem CID | 142539464 |
| Molecular Formula | C12H14CuN6S2 |
| Molecular Weight | 369.97 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | copper N-methyl-N'-[(E)-[(2E)-2-[(Z)-[methylamino(sulfido)methylidene]hydrazinylidene]-1-phenylethylidene]amino]carbamimidothioate |
| SMILES | CN/C([S-])=N/N=C/C(=N/N=C(\[S-])NC)c1ccccc1.[Cu+2] |
| InChI | InChI=1S/C12H16N6S2.Cu/c1-13-11(19)17-15-8-10(16-18-12(20)14-2)9-6-4-3-5-7-9;/h3-8H,1-2H3,(H2,13,17,19)(H2,14,18,20);/q;+2/p-2/b15-8+,16-10-; |
| InChIKey | ZODPJEPLRRFJPT-KFPVSTTHSA-L |
| XLogP | 0.62 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.97 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|