C26H32CuN6OS2 — CID 142539522
copper N'-[(E)-[(2E)-1-(4-acetylphenyl)-2-[(Z)-[diethylamino(sulfido)methylidene]hydrazinylidene]-2-phenylethylidene]amino]-N,N-diethylcarbamimidothioate (PubChem CID 142539522) has the molecular formula C26H32CuN6OS2 and a molecular weight of 572.26 g/mol. Its IUPAC name is copper N'-[(E)-[(2E)-1-(4-acetylphenyl)-2-[(Z)-[diethylamino(sulfido)methylidene]hydrazinylidene]-2-phenylethylidene]amino]-N,N-diethylcarbamimidothioate.
| Compound Name | copper N'-[(E)-[(2E)-1-(4-acetylphenyl)-2-[(Z)-[diethylamino(sulfido)methylidene]hydrazinylidene]-2-phenylethylidene]amino]-N,N-diethylcarbamimidothioate |
|---|---|
| PubChem CID | 142539522 |
| Molecular Formula | C26H32CuN6OS2 |
| Molecular Weight | 572.26 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | copper N'-[(E)-[(2E)-1-(4-acetylphenyl)-2-[(Z)-[diethylamino(sulfido)methylidene]hydrazinylidene]-2-phenylethylidene]amino]-N,N-diethylcarbamimidothioate |
| SMILES | CCN(CC)/C([S-])=N/N=C(C(=N/N=C(\[S-])N(CC)CC)/c1ccc(C(C)=O)cc1)\c1ccccc1.[Cu+2] |
| InChI | InChI=1S/C26H34N6OS2.Cu/c1-6-31(7-2)25(34)29-27-23(21-13-11-10-12-14-21)24(28-30-26(35)32(8-3)9-4)22-17-15-20(16-18-22)19(5)33;/h10-18H,6-9H2,1-5H3,(H,29,34)(H,30,35);/q;+2/p-2/b27-23+,28-24+; |
| InChIKey | XIEUWDCCJWGQSI-NKDVAEODSA-L |
| XLogP | 4.48 |
| TPSA | 72.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.26 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|