C24H25CuF5N6S2 — CID 142539327
copper N'-[(E)-[(2E)-2-[(Z)-[diethylamino(sulfido)methylidene]hydrazinylidene]-1-(2,3,4,5,6-pentafluorophenyl)-2-phenylethylidene]amino]-N,N-diethylcarbamimidothioate (PubChem CID 142539327) has the molecular formula C24H25CuF5N6S2 and a molecular weight of 620.18 g/mol. Its IUPAC name is copper N'-[(E)-[(2E)-2-[(Z)-[diethylamino(sulfido)methylidene]hydrazinylidene]-1-(2,3,4,5,6-pentafluorophenyl)-2-phenylethylidene]amino]-N,N-diethylcarbamimidothioate.
| Compound Name | copper N'-[(E)-[(2E)-2-[(Z)-[diethylamino(sulfido)methylidene]hydrazinylidene]-1-(2,3,4,5,6-pentafluorophenyl)-2-phenylethylidene]amino]-N,N-diethylcarbamimidothioate |
|---|---|
| PubChem CID | 142539327 |
| Molecular Formula | C24H25CuF5N6S2 |
| Molecular Weight | 620.18 g/mol |
| Exact Mass | 619.08 |
| IUPAC Name | copper N'-[(E)-[(2E)-2-[(Z)-[diethylamino(sulfido)methylidene]hydrazinylidene]-1-(2,3,4,5,6-pentafluorophenyl)-2-phenylethylidene]amino]-N,N-diethylcarbamimidothioate |
| SMILES | CCN(CC)/C([S-])=N/N=C(C(=N/N=C(\[S-])N(CC)CC)/c1c(F)c(F)c(F)c(F)c1F)\c1ccccc1.[Cu+2] |
| InChI | InChI=1S/C24H27F5N6S2.Cu/c1-5-34(6-2)23(36)32-30-21(14-12-10-9-11-13-14)22(31-33-24(37)35(7-3)8-4)15-16(25)18(27)20(29)19(28)17(15)26;/h9-13H,5-8H2,1-4H3,(H,32,36)(H,33,37);/q;+2/p-2/b30-21+,31-22+; |
| InChIKey | SDQUQAVSCMBMTK-GSIQQXGUSA-L |
| XLogP | 4.98 |
| TPSA | 55.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.18 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|