C24H30CuN6S3 — CID 158842399
copper N'-[[2-[[diethylamino(sulfido)methylidene]hydrazinylidene]-1-phenyl-2-(4-sulfanylphenyl)ethylidene]amino]-N,N-diethylcarbamimidothioate (PubChem CID 158842399) has the molecular formula C24H30CuN6S3 and a molecular weight of 562.29 g/mol. Its IUPAC name is copper N'-[[2-[[diethylamino(sulfido)methylidene]hydrazinylidene]-1-phenyl-2-(4-sulfanylphenyl)ethylidene]amino]-N,N-diethylcarbamimidothioate.
| Compound Name | copper N'-[[2-[[diethylamino(sulfido)methylidene]hydrazinylidene]-1-phenyl-2-(4-sulfanylphenyl)ethylidene]amino]-N,N-diethylcarbamimidothioate |
|---|---|
| PubChem CID | 158842399 |
| Molecular Formula | C24H30CuN6S3 |
| Molecular Weight | 562.29 g/mol |
| Exact Mass | 561.10 |
| IUPAC Name | copper N'-[[2-[[diethylamino(sulfido)methylidene]hydrazinylidene]-1-phenyl-2-(4-sulfanylphenyl)ethylidene]amino]-N,N-diethylcarbamimidothioate |
| SMILES | CCN(CC)C([S-])=NN=C(C(=NN=C([S-])N(CC)CC)c1ccc(S)cc1)c1ccccc1.[Cu+2] |
| InChI | InChI=1S/C24H32N6S3.Cu/c1-5-29(6-2)23(32)27-25-21(18-12-10-9-11-13-18)22(19-14-16-20(31)17-15-19)26-28-24(33)30(7-3)8-4;/h9-17,31H,5-8H2,1-4H3,(H,27,32)(H,28,33);/q;+2/p-2 |
| InChIKey | IYKIIPPTXGXDSX-UHFFFAOYSA-L |
| XLogP | 4.57 |
| TPSA | 55.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.29 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|