C31H46N6S2 — CID 170183855
pentan-2-yl N'-[(E)-[(2E)-2-[(Z)-[diethylamino(methylsulfanyl)methylidene]hydrazinylidene]-2-(4-methylphenyl)-1-phenylethylidene]amino]-N,N-diethylcarbamimidothioate (PubChem CID 170183855) has the molecular formula C31H46N6S2 and a molecular weight of 566.89 g/mol. Its IUPAC name is pentan-2-yl N'-[(E)-[(2E)-2-[(Z)-[diethylamino(methylsulfanyl)methylidene]hydrazinylidene]-2-(4-methylphenyl)-1-phenylethylidene]amino]-N,N-diethylcarbamimidothioate.
| Compound Name | pentan-2-yl N'-[(E)-[(2E)-2-[(Z)-[diethylamino(methylsulfanyl)methylidene]hydrazinylidene]-2-(4-methylphenyl)-1-phenylethylidene]amino]-N,N-diethylcarbamimidothioate |
|---|---|
| PubChem CID | 170183855 |
| Molecular Formula | C31H46N6S2 |
| Molecular Weight | 566.89 g/mol |
| Exact Mass | 566.32 |
| IUPAC Name | pentan-2-yl N'-[(E)-[(2E)-2-[(Z)-[diethylamino(methylsulfanyl)methylidene]hydrazinylidene]-2-(4-methylphenyl)-1-phenylethylidene]amino]-N,N-diethylcarbamimidothioate |
| SMILES | CCCC(C)S/C(=N\N=C(C(=N\N=C(/SC)N(CC)CC)\c1ccc(C)cc1)/c1ccccc1)N(CC)CC |
| InChI | InChI=1S/C31H46N6S2/c1-9-17-25(7)39-31(37(12-4)13-5)35-33-28(26-18-15-14-16-19-26)29(27-22-20-24(6)21-23-27)32-34-30(38-8)36(10-2)11-3/h14-16,18-23,25H,9-13,17H2,1-8H3/b32-29+,33-28+,34-30-,35-31- |
| InChIKey | FVQIGSQTMBMDQG-OBWVFLJYSA-N |
| XLogP | 7.78 |
| TPSA | 55.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.89 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|