C36H39N — CID 54020177
4-[4,4-bis(4-methylphenyl)-1-phenylbuta-1,3-dienyl]-N,N-dipropylaniline (PubChem CID 54020177) has the molecular formula C36H39N and a molecular weight of 485.72 g/mol. Its IUPAC name is 4-[4,4-bis(4-methylphenyl)-1-phenylbuta-1,3-dienyl]-N,N-dipropylaniline.
| Compound Name | 4-[4,4-bis(4-methylphenyl)-1-phenylbuta-1,3-dienyl]-N,N-dipropylaniline |
|---|---|
| PubChem CID | 54020177 |
| Molecular Formula | C36H39N |
| Molecular Weight | 485.72 g/mol |
| Exact Mass | 485.31 |
| IUPAC Name | 4-[4,4-bis(4-methylphenyl)-1-phenylbuta-1,3-dienyl]-N,N-dipropylaniline |
| SMILES | CCCN(CCC)c1ccc(C(=CC=C(c2ccc(C)cc2)c2ccc(C)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H39N/c1-5-26-37(27-6-2)34-22-20-33(21-23-34)35(30-10-8-7-9-11-30)24-25-36(31-16-12-28(3)13-17-31)32-18-14-29(4)15-19-32/h7-25H,5-6,26-27H2,1-4H3 |
| InChIKey | KYJLVOOMZHZHQV-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.72 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|