C24H22N6S2Zn — CID 56956464
zinc N'-[(E)-[(2E)-1,2-diphenyl-2-[(N-phenyl-C-sulfidocarbonimidoyl)hydrazinylidene]ethylidene]amino]-N,N-dimethylcarbamimidothioate (PubChem CID 56956464) has the molecular formula C24H22N6S2Zn and a molecular weight of 524.01 g/mol. Its IUPAC name is zinc N'-[(E)-[(2E)-1,2-diphenyl-2-[(N-phenyl-C-sulfidocarbonimidoyl)hydrazinylidene]ethylidene]amino]-N,N-dimethylcarbamimidothioate.
| Compound Name | zinc N'-[(E)-[(2E)-1,2-diphenyl-2-[(N-phenyl-C-sulfidocarbonimidoyl)hydrazinylidene]ethylidene]amino]-N,N-dimethylcarbamimidothioate |
|---|---|
| PubChem CID | 56956464 |
| Molecular Formula | C24H22N6S2Zn |
| Molecular Weight | 524.01 g/mol |
| Exact Mass | 522.06 |
| IUPAC Name | zinc N'-[(E)-[(2E)-1,2-diphenyl-2-[(N-phenyl-C-sulfidocarbonimidoyl)hydrazinylidene]ethylidene]amino]-N,N-dimethylcarbamimidothioate |
| SMILES | CN(C)/C([S-])=N/N=C(C(=N/N/C([S-])=N/c1ccccc1)/c1ccccc1)\c1ccccc1.[Zn+2] |
| InChI | InChI=1S/C24H24N6S2.Zn/c1-30(2)24(32)29-27-22(19-14-8-4-9-15-19)21(18-12-6-3-7-13-18)26-28-23(31)25-20-16-10-5-11-17-20;/h3-17H,1-2H3,(H,29,32)(H2,25,28,31);/q;+2/p-2/b26-21+,27-22+; |
| InChIKey | WBFLFDLCTGVMOP-OZPLOXNPSA-L |
| XLogP | 4.08 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.01 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|