C36H28N10S2Zn — CID 25193925
zinc bis(N-(dipyridin-2-ylmethylideneamino)-N'-phenylcarbamimidothioate) (PubChem CID 25193925) has the molecular formula C36H28N10S2Zn and a molecular weight of 730.21 g/mol. Its IUPAC name is zinc bis(N-(dipyridin-2-ylmethylideneamino)-N'-phenylcarbamimidothioate).
| Compound Name | zinc bis(N-(dipyridin-2-ylmethylideneamino)-N'-phenylcarbamimidothioate) |
|---|---|
| PubChem CID | 25193925 |
| Molecular Formula | C36H28N10S2Zn |
| Molecular Weight | 730.21 g/mol |
| Exact Mass | 728.12 |
| IUPAC Name | zinc bis(N-(dipyridin-2-ylmethylideneamino)-N'-phenylcarbamimidothioate) |
| SMILES | [S-]/C(=N/c1ccccc1)NN=C(c1ccccn1)c1ccccn1.[S-]/C(=N\c1ccccc1)NN=C(c1ccccn1)c1ccccn1.[Zn+2] |
| InChI | InChI=1S/2C18H15N5S.Zn/c2*24-18(21-14-8-2-1-3-9-14)23-22-17(15-10-4-6-12-19-15)16-11-5-7-13-20-16;/h2*1-13H,(H2,21,23,24);/q;;+2/p-2 |
| InChIKey | ZREOCNMXOFNJTE-UHFFFAOYSA-L |
| XLogP | 6.10 |
| TPSA | 125.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.21 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|