About gallium bis(N'-(4-methylphenyl)-N-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate)
gallium bis(N'-(4-methylphenyl)-N-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate) (PubChem CID 86574543) has the molecular formula C30H30GaN8S2+
and a molecular weight of 636.48 g/mol. Its IUPAC name is gallium bis(N'-(4-methylphenyl)-N-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate).
Molecular Properties
| Compound Name | gallium bis(N'-(4-methylphenyl)-N-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate) |
| PubChem CID | 86574543 |
| Molecular Formula | C30H30GaN8S2+ |
| Molecular Weight | 636.48 g/mol |
| Exact Mass | 635.13 |
| IUPAC Name | gallium bis(N'-(4-methylphenyl)-N-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate) |
| SMILES | C/C(=N\N/C([S-])=N/c1ccc(C)cc1)c1ccccn1.C/C(=N\N/C([S-])=N\c1ccc(C)cc1)c1ccccn1.[Ga+3] |
| InChI | InChI=1S/2C15H16N4S.Ga/c2*1-11-6-8-13(9-7-11)17-15(20)19-18-12(2)14-5-3-4-10-16-14;/h2*3-10H,1-2H3,(H2,17,19,20);/q;;+3/p-2/b2*18-12+; |
| InChIKey | SKQQDCIMSDYHGL-XCSIXQCQSA-L |
| XLogP | 5.50 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 636.48 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze gallium bis(N'-(4-methylphenyl)-N-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gallium bis(N'-(4-methylphenyl)-N-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate)?
The IUPAC name of gallium bis(N'-(4-methylphenyl)-N-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate) (CID 86574543) is gallium bis(N'-(4-methylphenyl)-N-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate).
What is the SMILES notation for gallium bis(N'-(4-methylphenyl)-N-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate)?
The canonical SMILES for gallium bis(N'-(4-methylphenyl)-N-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate) is C/C(=N\N/C([S-])=N/c1ccc(C)cc1)c1ccccn1.C/C(=N\N/C([S-])=N\c1ccc(C)cc1)c1ccccn1.[Ga+3].
What is the InChIKey of gallium bis(N'-(4-methylphenyl)-N-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate)?
The InChIKey is SKQQDCIMSDYHGL-XCSIXQCQSA-L. The full InChI is InChI=1S/2C15H16N4S.Ga/c2*1-11-6-8-13(9-7-11)17-15(20)19-18-12(2)14-5-3-4-10-16-14;/h2*3-10H,1-2H3,(H2,17,19,20);/q;;+3/p-2/b2*18-12+;.
What are the key properties of gallium bis(N'-(4-methylphenyl)-N-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate)?
gallium bis(N'-(4-methylphenyl)-N-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate) has a molecular weight of 636.48 g/mol, XLogP of 5.50, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for gallium bis(N'-(4-methylphenyl)-N-[(E)-1-pyridin-2-ylethylideneamino]carbamimidothioate) is sourced from PubChem (CID 86574543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).