C21H33CuN7S2 — CID 158862607
copper N'-[[1-[[diethylamino(sulfido)methylidene]hydrazinylidene]-1-[4-(dimethylamino)phenyl]propan-2-ylidene]amino]-N,N-diethylcarbamimidothioate (PubChem CID 158862607) has the molecular formula C21H33CuN7S2 and a molecular weight of 511.22 g/mol. Its IUPAC name is copper N'-[[1-[[diethylamino(sulfido)methylidene]hydrazinylidene]-1-[4-(dimethylamino)phenyl]propan-2-ylidene]amino]-N,N-diethylcarbamimidothioate.
| Compound Name | copper N'-[[1-[[diethylamino(sulfido)methylidene]hydrazinylidene]-1-[4-(dimethylamino)phenyl]propan-2-ylidene]amino]-N,N-diethylcarbamimidothioate |
|---|---|
| PubChem CID | 158862607 |
| Molecular Formula | C21H33CuN7S2 |
| Molecular Weight | 511.22 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | copper N'-[[1-[[diethylamino(sulfido)methylidene]hydrazinylidene]-1-[4-(dimethylamino)phenyl]propan-2-ylidene]amino]-N,N-diethylcarbamimidothioate |
| SMILES | CCN(CC)C([S-])=NN=C(C)C(=NN=C([S-])N(CC)CC)c1ccc(N(C)C)cc1.[Cu+2] |
| InChI | InChI=1S/C21H35N7S2.Cu/c1-8-27(9-2)20(29)24-22-16(5)19(23-25-21(30)28(10-3)11-4)17-12-14-18(15-13-17)26(6)7;/h12-15H,8-11H2,1-7H3,(H,24,29)(H,25,30);/q;+2/p-2 |
| InChIKey | JAVHZGCUBMANDA-UHFFFAOYSA-L |
| XLogP | 3.32 |
| TPSA | 59.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.22 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|