C38H39N7OPS2+ — CID 159279407
2-[[[2-(4-aminophenyl)-2-(methylcarbamothioylhydrazinylidene)-1-phenylethylidene]amino]carbamothioylamino]ethoxymethyl-triphenylphosphanium (PubChem CID 159279407) has the molecular formula C38H39N7OPS2+ and a molecular weight of 704.89 g/mol. Its IUPAC name is 2-[[[2-(4-aminophenyl)-2-(methylcarbamothioylhydrazinylidene)-1-phenylethylidene]amino]carbamothioylamino]ethoxymethyl-triphenylphosphanium.
| Compound Name | 2-[[[2-(4-aminophenyl)-2-(methylcarbamothioylhydrazinylidene)-1-phenylethylidene]amino]carbamothioylamino]ethoxymethyl-triphenylphosphanium |
|---|---|
| PubChem CID | 159279407 |
| Molecular Formula | C38H39N7OPS2+ |
| Molecular Weight | 704.89 g/mol |
| Exact Mass | 704.24 |
| IUPAC Name | 2-[[[2-(4-aminophenyl)-2-(methylcarbamothioylhydrazinylidene)-1-phenylethylidene]amino]carbamothioylamino]ethoxymethyl-triphenylphosphanium |
| SMILES | CNC(=S)NN=C(C(=NNC(=S)NCCOC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1)c1ccc(N)cc1 |
| InChI | InChI=1S/C38H38N7OPS2/c1-40-37(48)44-42-36(30-22-24-31(39)25-23-30)35(29-14-6-2-7-15-29)43-45-38(49)41-26-27-46-28-47(32-16-8-3-9-17-32,33-18-10-4-11-19-33)34-20-12-5-13-21-34/h2-25H,26-28H2,1H3,(H5-,39,40,41,42,43,44,45,48,49)/p+1 |
| InChIKey | BONWHLNEUPTTAI-UHFFFAOYSA-O |
| XLogP | 4.90 |
| TPSA | 108.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.89 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hzone_anil(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|