C25H37N9OS2 — CID 154933035
1-[4-(2-amino-3-methylbutan-2-yl)oxy-2-methylbutan-2-yl]-3-[(E)-[(2Z)-2-(methylcarbamothioylhydrazinylidene)-1-phenyl-2-pyrimidin-2-ylethylidene]amino]thiourea (PubChem CID 154933035) has the molecular formula C25H37N9OS2 and a molecular weight of 543.77 g/mol. Its IUPAC name is 1-[4-(2-amino-3-methylbutan-2-yl)oxy-2-methylbutan-2-yl]-3-[(E)-[(2Z)-2-(methylcarbamothioylhydrazinylidene)-1-phenyl-2-pyrimidin-2-ylethylidene]amino]thiourea.
| Compound Name | 1-[4-(2-amino-3-methylbutan-2-yl)oxy-2-methylbutan-2-yl]-3-[(E)-[(2Z)-2-(methylcarbamothioylhydrazinylidene)-1-phenyl-2-pyrimidin-2-ylethylidene]amino]thiourea |
|---|---|
| PubChem CID | 154933035 |
| Molecular Formula | C25H37N9OS2 |
| Molecular Weight | 543.77 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | 1-[4-(2-amino-3-methylbutan-2-yl)oxy-2-methylbutan-2-yl]-3-[(E)-[(2Z)-2-(methylcarbamothioylhydrazinylidene)-1-phenyl-2-pyrimidin-2-ylethylidene]amino]thiourea |
| SMILES | CNC(=S)N/N=C(C(=N/NC(=S)NC(C)(C)CCOC(C)(N)C(C)C)/c1ccccc1)\c1ncccn1 |
| InChI | InChI=1S/C25H37N9OS2/c1-17(2)25(5,26)35-16-13-24(3,4)30-23(37)34-31-19(18-11-8-7-9-12-18)20(32-33-22(36)27-6)21-28-14-10-15-29-21/h7-12,14-15,17H,13,16,26H2,1-6H3,(H2,27,33,36)(H2,30,34,37)/b31-19+,32-20- |
| InChIKey | OKJKVUXOBINBOE-JQBZGFCWSA-N |
| XLogP | 2.66 |
| TPSA | 133.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.77 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|