C40H42N6OPS2+ — CID 160766069
2-[[[2-(4-ethylphenyl)-2-(methylcarbamothioylhydrazinylidene)-1-phenylethylidene]amino]carbamothioylamino]ethoxymethyl-triphenylphosphanium (PubChem CID 160766069) has the molecular formula C40H42N6OPS2+ and a molecular weight of 717.93 g/mol. Its IUPAC name is 2-[[[2-(4-ethylphenyl)-2-(methylcarbamothioylhydrazinylidene)-1-phenylethylidene]amino]carbamothioylamino]ethoxymethyl-triphenylphosphanium.
| Compound Name | 2-[[[2-(4-ethylphenyl)-2-(methylcarbamothioylhydrazinylidene)-1-phenylethylidene]amino]carbamothioylamino]ethoxymethyl-triphenylphosphanium |
|---|---|
| PubChem CID | 160766069 |
| Molecular Formula | C40H42N6OPS2+ |
| Molecular Weight | 717.93 g/mol |
| Exact Mass | 717.26 |
| IUPAC Name | 2-[[[2-(4-ethylphenyl)-2-(methylcarbamothioylhydrazinylidene)-1-phenylethylidene]amino]carbamothioylamino]ethoxymethyl-triphenylphosphanium |
| SMILES | CCc1ccc(C(=NNC(=S)NC)C(=NNC(=S)NCCOC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C40H41N6OPS2/c1-3-31-24-26-33(27-25-31)38(43-45-39(49)41-2)37(32-16-8-4-9-17-32)44-46-40(50)42-28-29-47-30-48(34-18-10-5-11-19-34,35-20-12-6-13-21-35)36-22-14-7-15-23-36/h4-27H,3,28-30H2,1-2H3,(H3-,41,42,43,44,45,46,49,50)/p+1 |
| InChIKey | KWKYYKGOVDBYQU-UHFFFAOYSA-O |
| XLogP | 5.88 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.93 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|