C20H33NO2 — CID 87364737
3-butyl-1-hydroxyimino-1-phenyldecan-2-ol (PubChem CID 87364737) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is 3-butyl-1-hydroxyimino-1-phenyldecan-2-ol.
| Compound Name | 3-butyl-1-hydroxyimino-1-phenyldecan-2-ol |
|---|---|
| PubChem CID | 87364737 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | 3-butyl-1-hydroxyimino-1-phenyldecan-2-ol |
| SMILES | CCCCCCCC(CCCC)C(O)C(=NO)c1ccccc1 |
| InChI | InChI=1S/C20H33NO2/c1-3-5-7-8-10-16-18(13-6-4-2)20(22)19(21-23)17-14-11-9-12-15-17/h9,11-12,14-15,18,20,22-23H,3-8,10,13,16H2,1-2H3 |
| InChIKey | MKRXBIJYBSELJJ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|