About [(E)-1-bromo-2,3-diphenylbut-1-enyl]benzene
[(E)-1-bromo-2,3-diphenylbut-1-enyl]benzene (PubChem CID 177475796) has the molecular formula C22H19Br
and a molecular weight of 363.30 g/mol. Its IUPAC name is [(E)-1-bromo-2,3-diphenylbut-1-enyl]benzene.
Molecular Properties
| Compound Name | [(E)-1-bromo-2,3-diphenylbut-1-enyl]benzene |
| PubChem CID | 177475796 |
| Molecular Formula | C22H19Br |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | [(E)-1-bromo-2,3-diphenylbut-1-enyl]benzene |
| SMILES | CC(/C(=C(\Br)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19Br/c1-17(18-11-5-2-6-12-18)21(19-13-7-3-8-14-19)22(23)20-15-9-4-10-16-20/h2-17H,1H3/b22-21+ |
| InChIKey | MKGMQZBOOSXPAM-QURGRASLSA-N |
| XLogP | 6.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1-bromo-2,3-diphenylbut-1-enyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1-bromo-2,3-diphenylbut-1-enyl]benzene?
The IUPAC name of [(E)-1-bromo-2,3-diphenylbut-1-enyl]benzene (CID 177475796) is [(E)-1-bromo-2,3-diphenylbut-1-enyl]benzene.
What is the SMILES notation for [(E)-1-bromo-2,3-diphenylbut-1-enyl]benzene?
The canonical SMILES for [(E)-1-bromo-2,3-diphenylbut-1-enyl]benzene is CC(/C(=C(\Br)c1ccccc1)c1ccccc1)c1ccccc1.
What is the InChIKey of [(E)-1-bromo-2,3-diphenylbut-1-enyl]benzene?
The InChIKey is MKGMQZBOOSXPAM-QURGRASLSA-N. The full InChI is InChI=1S/C22H19Br/c1-17(18-11-5-2-6-12-18)21(19-13-7-3-8-14-19)22(23)20-15-9-4-10-16-20/h2-17H,1H3/b22-21+.
What are the key properties of [(E)-1-bromo-2,3-diphenylbut-1-enyl]benzene?
[(E)-1-bromo-2,3-diphenylbut-1-enyl]benzene has a molecular weight of 363.30 g/mol, XLogP of 6.75, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1-bromo-2,3-diphenylbut-1-enyl]benzene is sourced from PubChem (CID 177475796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).