C8H7F2NO — CID 22769392
(NZ)-N-(2,2-difluoro-1-phenylethylidene)hydroxylamine (PubChem CID 22769392) has the molecular formula C8H7F2NO and a molecular weight of 171.15 g/mol. Its IUPAC name is (NZ)-N-(2,2-difluoro-1-phenylethylidene)hydroxylamine.
| Compound Name | (NZ)-N-(2,2-difluoro-1-phenylethylidene)hydroxylamine |
|---|---|
| PubChem CID | 22769392 |
| Molecular Formula | C8H7F2NO |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | (NZ)-N-(2,2-difluoro-1-phenylethylidene)hydroxylamine |
| SMILES | O/N=C(/c1ccccc1)C(F)F |
| InChI | InChI=1S/C8H7F2NO/c9-8(10)7(11-12)6-4-2-1-3-5-6/h1-5,8,12H/b11-7- |
| InChIKey | APNKYQXREOWSPN-XFFZJAGNSA-N |
| XLogP | 2.13 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|