C15H15NO3S — CID 174925218
N-(2-methylsulfonyl-1,2-diphenylethylidene)hydroxylamine (PubChem CID 174925218) has the molecular formula C15H15NO3S and a molecular weight of 289.36 g/mol. Its IUPAC name is N-(2-methylsulfonyl-1,2-diphenylethylidene)hydroxylamine.
| Compound Name | N-(2-methylsulfonyl-1,2-diphenylethylidene)hydroxylamine |
|---|---|
| PubChem CID | 174925218 |
| Molecular Formula | C15H15NO3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | N-(2-methylsulfonyl-1,2-diphenylethylidene)hydroxylamine |
| SMILES | CS(=O)(=O)C(C(=NO)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H15NO3S/c1-20(18,19)15(13-10-6-3-7-11-13)14(16-17)12-8-4-2-5-9-12/h2-11,15,17H,1H3 |
| InChIKey | NTLYJPGFUVWGOA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|