C16H18O4S2 — CID 57219962
hydroxy-methyl-(2-methylsulfonyl-1,2-diphenylethylidene)-oxo-λ6-sulfane (PubChem CID 57219962) has the molecular formula C16H18O4S2 and a molecular weight of 338.45 g/mol. Its IUPAC name is hydroxy-methyl-(2-methylsulfonyl-1,2-diphenylethylidene)-oxo-λ6-sulfane.
| Compound Name | hydroxy-methyl-(2-methylsulfonyl-1,2-diphenylethylidene)-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 57219962 |
| Molecular Formula | C16H18O4S2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | hydroxy-methyl-(2-methylsulfonyl-1,2-diphenylethylidene)-oxo-λ6-sulfane |
| SMILES | CS(=O)(=O)C(C(c1ccccc1)=S(C)(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H18O4S2/c1-21(17,18)15(13-9-5-3-6-10-13)16(22(2,19)20)14-11-7-4-8-12-14/h3-12,15H,1-2H3,(H,19,20) |
| InChIKey | VOGLRSPDXDDOCI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|