C15H20 — CID 123891099
4-methylocta-4,6-dien-3-ylbenzene (PubChem CID 123891099) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is 4-methylocta-4,6-dien-3-ylbenzene.
| Compound Name | 4-methylocta-4,6-dien-3-ylbenzene |
|---|---|
| PubChem CID | 123891099 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 4-methylocta-4,6-dien-3-ylbenzene |
| SMILES | CC=CC=C(C)C(CC)c1ccccc1 |
| InChI | InChI=1S/C15H20/c1-4-6-10-13(3)15(5-2)14-11-8-7-9-12-14/h4,6-12,15H,5H2,1-3H3 |
| InChIKey | UEHZLWNQUSGTSP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|