C15H22BrNO — CID 114314563
N-(1-bromo-2-methylbutan-2-yl)-2-phenylbutanamide (PubChem CID 114314563) has the molecular formula C15H22BrNO and a molecular weight of 312.25 g/mol. Its IUPAC name is N-(1-bromo-2-methylbutan-2-yl)-2-phenylbutanamide.
| Compound Name | N-(1-bromo-2-methylbutan-2-yl)-2-phenylbutanamide |
|---|---|
| PubChem CID | 114314563 |
| Molecular Formula | C15H22BrNO |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-(1-bromo-2-methylbutan-2-yl)-2-phenylbutanamide |
| SMILES | CCC(C(=O)NC(C)(CC)CBr)c1ccccc1 |
| InChI | InChI=1S/C15H22BrNO/c1-4-13(12-9-7-6-8-10-12)14(18)17-15(3,5-2)11-16/h6-10,13H,4-5,11H2,1-3H3,(H,17,18) |
| InChIKey | BGUDZSFYZVSIDF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|