C17H28N2O — CID 115309768
N-(1-amino-2,4-dimethylpentan-2-yl)-2-phenylbutanamide (PubChem CID 115309768) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is N-(1-amino-2,4-dimethylpentan-2-yl)-2-phenylbutanamide.
| Compound Name | N-(1-amino-2,4-dimethylpentan-2-yl)-2-phenylbutanamide |
|---|---|
| PubChem CID | 115309768 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | N-(1-amino-2,4-dimethylpentan-2-yl)-2-phenylbutanamide |
| SMILES | CCC(C(=O)NC(C)(CN)CC(C)C)c1ccccc1 |
| InChI | InChI=1S/C17H28N2O/c1-5-15(14-9-7-6-8-10-14)16(20)19-17(4,12-18)11-13(2)3/h6-10,13,15H,5,11-12,18H2,1-4H3,(H,19,20) |
| InChIKey | DJAOFAOMZBQTNU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |