C16H27N3O — CID 122080681
3-amino-N-(1-amino-2,4-dimethylpentan-2-yl)-3-phenylpropanamide (PubChem CID 122080681) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is 3-amino-N-(1-amino-2,4-dimethylpentan-2-yl)-3-phenylpropanamide.
| Compound Name | 3-amino-N-(1-amino-2,4-dimethylpentan-2-yl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 122080681 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | 3-amino-N-(1-amino-2,4-dimethylpentan-2-yl)-3-phenylpropanamide |
| SMILES | CC(C)CC(C)(CN)NC(=O)CC(N)c1ccccc1 |
| InChI | InChI=1S/C16H27N3O/c1-12(2)10-16(3,11-17)19-15(20)9-14(18)13-7-5-4-6-8-13/h4-8,12,14H,9-11,17-18H2,1-3H3,(H,19,20) |
| InChIKey | LOOHFYQOGJOBHX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |