C18H30N2O — CID 119599953
N-(1-amino-2,4-dimethylpentan-2-yl)-3-phenylpentanamide (PubChem CID 119599953) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is N-(1-amino-2,4-dimethylpentan-2-yl)-3-phenylpentanamide.
| Compound Name | N-(1-amino-2,4-dimethylpentan-2-yl)-3-phenylpentanamide |
|---|---|
| PubChem CID | 119599953 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | N-(1-amino-2,4-dimethylpentan-2-yl)-3-phenylpentanamide |
| SMILES | CCC(CC(=O)NC(C)(CN)CC(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H30N2O/c1-5-15(16-9-7-6-8-10-16)11-17(21)20-18(4,13-19)12-14(2)3/h6-10,14-15H,5,11-13,19H2,1-4H3,(H,20,21) |
| InChIKey | IEGOEMVRPWFSKG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |