C20H30ClFN2O — CID 143249851
(2E,4Z)-2-[(E)-1-chloroprop-1-en-2-yl]-N-(1-phenylethyl)hexa-2,4-dien-1-amine;N-fluoro-N-methylmethanamine;formaldehyde (PubChem CID 143249851) has the molecular formula C20H30ClFN2O and a molecular weight of 368.92 g/mol. Its IUPAC name is (2E,4Z)-2-[(E)-1-chloroprop-1-en-2-yl]-N-(1-phenylethyl)hexa-2,4-dien-1-amine;N-fluoro-N-methylmethanamine;formaldehyde.
| Compound Name | (2E,4Z)-2-[(E)-1-chloroprop-1-en-2-yl]-N-(1-phenylethyl)hexa-2,4-dien-1-amine;N-fluoro-N-methylmethanamine;formaldehyde |
|---|---|
| PubChem CID | 143249851 |
| Molecular Formula | C20H30ClFN2O |
| Molecular Weight | 368.92 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (2E,4Z)-2-[(E)-1-chloroprop-1-en-2-yl]-N-(1-phenylethyl)hexa-2,4-dien-1-amine;N-fluoro-N-methylmethanamine;formaldehyde |
| SMILES | C/C=C\C=C(CNC(C)c1ccccc1)/C(C)=C/Cl.C=O.CN(C)F |
| InChI | InChI=1S/C17H22ClN.C2H6FN.CH2O/c1-4-5-9-17(14(2)12-18)13-19-15(3)16-10-7-6-8-11-16;1-4(2)3;1-2/h4-12,15,19H,13H2,1-3H3;1-2H3;1H2/b5-4-,14-12+,17-9-;; |
| InChIKey | IHQXFWJFTGTSIM-ITYKGGKVSA-N |
| XLogP | 5.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.92 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|