C24H33NO — CID 144927499
ethane;(3E)-3-ethenyl-2-methyl-1-(5-phenyl-2-pyridinyl)hexa-3,5-dien-2-ol (PubChem CID 144927499) has the molecular formula C24H33NO and a molecular weight of 351.53 g/mol. Its IUPAC name is ethane;(3E)-3-ethenyl-2-methyl-1-(5-phenyl-2-pyridinyl)hexa-3,5-dien-2-ol.
| Compound Name | ethane;(3E)-3-ethenyl-2-methyl-1-(5-phenyl-2-pyridinyl)hexa-3,5-dien-2-ol |
|---|---|
| PubChem CID | 144927499 |
| Molecular Formula | C24H33NO |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.26 |
| IUPAC Name | ethane;(3E)-3-ethenyl-2-methyl-1-(5-phenyl-2-pyridinyl)hexa-3,5-dien-2-ol |
| SMILES | C=C/C=C(\C=C)C(C)(O)Cc1ccc(-c2ccccc2)cn1.CC.CC |
| InChI | InChI=1S/C20H21NO.2C2H6/c1-4-9-18(5-2)20(3,22)14-19-13-12-17(15-21-19)16-10-7-6-8-11-16;2*1-2/h4-13,15,22H,1-2,14H2,3H3;2*1-2H3/b18-9+;; |
| InChIKey | CJDXFSASYRHGLD-IFJQNBRBSA-N |
| XLogP | 6.39 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|