C15H22O — CID 142173895
(3E,5Z)-3-methyl-4-[(2E,4Z)-4-methylhexa-2,4-dien-3-yl]oxyhepta-1,3,5-triene (PubChem CID 142173895) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (3E,5Z)-3-methyl-4-[(2E,4Z)-4-methylhexa-2,4-dien-3-yl]oxyhepta-1,3,5-triene.
| Compound Name | (3E,5Z)-3-methyl-4-[(2E,4Z)-4-methylhexa-2,4-dien-3-yl]oxyhepta-1,3,5-triene |
|---|---|
| PubChem CID | 142173895 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (3E,5Z)-3-methyl-4-[(2E,4Z)-4-methylhexa-2,4-dien-3-yl]oxyhepta-1,3,5-triene |
| SMILES | C=C/C(C)=C(\C=C/C)OC(=C/C)/C(C)=C\C |
| InChI | InChI=1S/C15H22O/c1-7-11-15(13(6)9-3)16-14(10-4)12(5)8-2/h7-11H,3H2,1-2,4-6H3/b11-7-,12-8-,14-10+,15-13+ |
| InChIKey | AAUZSRHMMPTBGX-QSDWUHHOSA-N |
| XLogP | 4.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|