C8H11NS — CID 143498484
(3Z,5Z)-4-(methylideneamino)hepta-1,3,5-triene-3-thiol (PubChem CID 143498484) has the molecular formula C8H11NS and a molecular weight of 153.25 g/mol. Its IUPAC name is (3Z,5Z)-4-(methylideneamino)hepta-1,3,5-triene-3-thiol.
| Compound Name | (3Z,5Z)-4-(methylideneamino)hepta-1,3,5-triene-3-thiol |
|---|---|
| PubChem CID | 143498484 |
| Molecular Formula | C8H11NS |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | (3Z,5Z)-4-(methylideneamino)hepta-1,3,5-triene-3-thiol |
| SMILES | C=C/C(S)=C(\C=C/C)N=C |
| InChI | InChI=1S/C8H11NS/c1-4-6-7(9-3)8(10)5-2/h4-6,10H,2-3H2,1H3/b6-4-,8-7- |
| InChIKey | PNGZFDDJADJZDF-MOIRPGTBSA-N |
| XLogP | 2.59 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|