C10H15NS — CID 167066070
(1Z,4Z)-1-(methylideneamino)-3-propan-2-ylidenehexa-1,4-diene-2-thiol (PubChem CID 167066070) has the molecular formula C10H15NS and a molecular weight of 181.30 g/mol. Its IUPAC name is (1Z,4Z)-1-(methylideneamino)-3-propan-2-ylidenehexa-1,4-diene-2-thiol.
| Compound Name | (1Z,4Z)-1-(methylideneamino)-3-propan-2-ylidenehexa-1,4-diene-2-thiol |
|---|---|
| PubChem CID | 167066070 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | (1Z,4Z)-1-(methylideneamino)-3-propan-2-ylidenehexa-1,4-diene-2-thiol |
| SMILES | C=N/C=C(/S)C(/C=C\C)=C(C)C |
| InChI | InChI=1S/C10H15NS/c1-5-6-9(8(2)3)10(12)7-11-4/h5-7,12H,4H2,1-3H3/b6-5-,10-7- |
| InChIKey | DARLKQGKWQTQKF-ICZHLNMZSA-N |
| XLogP | 3.37 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|